CAS 1255717-52-2

3,6-Pyridazinedione, 1-(2-aminoethyl)-1,2-dihydro-, hydrochloride (1:1)

Description:

3,6-Pyridazinedione, 1-(2-aminoethyl)-1,2-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine core, which features a six-membered ring containing two nitrogen atoms at positions 3 and 6. This compound is a hydrochloride salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in water. The presence of the 2-aminoethyl group suggests that it has potential biological activity, possibly interacting with various biological targets due to the amino group, which can participate in hydrogen bonding and other interactions. The dihydro form indicates that the compound may exist in a reduced state, which can influence its reactivity and stability. As a hydrochloride, it is likely to be more stable and easier to handle compared to its free base form. Overall, this compound may have applications in medicinal chemistry or as a research tool, although specific biological activities would require further investigation.

Formula: C₆H₉N₃O₂.ClH

InChI: InChI=1S/C6H9N3O2.ClH/c7-3-4-9-6(11)2-1-5(10)8-9;/h1-2H,3-4,7H2,(H,8,10);1H

InChI key: InChIKey=CDOCBUDXPUDEKZ-UHFFFAOYSA-N

SMILES: C(CN)N1C(=O)C=CC(=O)N1.Cl

1-(2-aminoethyl)-1,2-dihydro-3,6-pyridazinedione hydrochloride

CAS: 1255717-52-2

Formula: C₆H₁₀ClN₃O₂

Purity: 95.0%

Molecular weight: 191.62

Ref: 10-F359019