CAS 1255717-63-5

1H-Benzimidazole-2-methanamine, 6-methoxy-, hydrochloride (1:2)

Description:

1H-Benzimidazole-2-methanamine, 6-methoxy-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a methanamine group at the 2-position and a methoxy group at the 6-position contributes to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit biological activity, potentially acting as a pharmacological agent, although specific activities would depend on its interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting various diseases. The compound's stability, solubility, and reactivity can be influenced by the presence of the hydrochloride moiety, making it an interesting subject for further research in both synthetic and medicinal chemistry.

Formula: C₉H₁₁N₃O·2ClH

InChI: InChI=1S/C9H11N3O.2ClH/c1-13-6-2-3-7-8(4-6)12-9(5-10)11-7;;/h2-4H,5,10H2,1H3,(H,11,12);2*1H

InChI key: InChIKey=FGNLSJXLMAQALY-UHFFFAOYSA-N

SMILES: C(N)C=1NC=2C(N1)=CC=C(OC)C2.Cl

Synonyms:

• 1H-Benzimidazole-2-methanamine, 6-methoxy-, hydrochloride (1:2)

[(5-methoxy-1H-benzimidazol-2-yl)methyl]amine dihydrochloride

CAS: 1255717-63-5

Formula: C₉H₁₃Cl₂N₃O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 250.12

Ref: 10-F308600