CAS 1255717-67-9

2-Pyrrolidinemethanamine, 1-methyl-, hydrochloride (1:2)

Description:

2-Pyrrolidinemethanamine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and a pyrrolidine ring structure. This substance is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base compound, which enhances its solubility in water and stability. It typically appears as a white crystalline powder. The presence of the methyl group on the nitrogen atom contributes to its basicity and potential reactivity. This compound may be utilized in various applications, including pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and formulations. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks. Overall, 2-Pyrrolidinemethanamine, 1-methyl-, hydrochloride is of interest in both academic and industrial chemistry contexts.

Formula: C₆H₁₄N₂·2ClH

InChI: InChI=1S/C6H14N2.2ClH/c1-8-4-2-3-6(8)5-7;;/h6H,2-5,7H2,1H3;2*1H

InChI key: InChIKey=IJGRIKWUFZJOEJ-UHFFFAOYSA-N

SMILES: C(N)C1N(C)CCC1.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, 1-methyl-, hydrochloride (1:2)

[(1-methyl-2-pyrrolidinyl)methyl]amine dihydrochloride

CAS: 1255717-67-9

Formula: C₆H₁₆Cl₂N₂

Purity: 95.0%

Molecular weight: 187.11

Ref: 10-F361010