CAS 1255717-87-3

2-Thiazolemethanamine, α-ethyl-, hydrochloride (1:2)

Description:

2-Thiazolemethanamine, α-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The thiazole moiety imparts potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit basic properties due to the amine functional group, which can participate in protonation, enhancing its solubility in acidic conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 2-Thiazolemethanamine, α-ethyl-, hydrochloride (1:2) represents a compound with intriguing chemical characteristics that warrant further investigation in various scientific fields.

Formula: C₆H₁₀N₂S·2ClH

InChI: InChI=1S/C6H10N2S.2ClH/c1-2-5(7)6-8-3-4-9-6;;/h3-5H,2,7H2,1H3;2*1H

InChI key: InChIKey=CJGWSBKZSVHWKS-UHFFFAOYSA-N

SMILES: C(CC)(N)C1=NC=CS1.Cl

Synonyms:

• 2-Thiazolemethanamine, α-ethyl-, hydrochloride (1:2)

[1-(1,3-thiazol-2-yl)propyl]amine dihydrochloride

CAS: 1255717-87-3

Formula: C₆H₁₂Cl₂N₂S

Purity: 95.0%

Molecular weight: 215.14

Ref: 10-F358980