CAS 1255717-89-5

1H-Pyrazole-1-acetic acid, 5-amino-3-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-acetic acid, 5-amino-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an acetic acid functional group, contributing to its acidic properties, and an amino group that enhances its potential for biological activity. The presence of the methyl group at the 3-position of the pyrazole ring adds to its structural complexity and may influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit biological activities, potentially serving as a scaffold for drug development. Its CAS number, 1255717-89-5, allows for precise identification in chemical databases. Overall, this compound's unique structural features and functional groups suggest potential utility in medicinal chemistry and related fields.

Formula: C₆H₉N₃O₂·ClH

InChI: InChI=1S/C6H9N3O2.ClH/c1-4-2-5(7)9(8-4)3-6(10)11;/h2H,3,7H2,1H3,(H,10,11);1H

InChI key: InChIKey=YPFOTRUPJDITOG-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(C)C=C1N.Cl

Synonyms:

• 1H-Pyrazole-1-acetic acid, 5-amino-3-methyl-, hydrochloride (1:1)

(5-Amino-3-methyl-1H-pyrazol-1-yl)acetic acid hydrochloride

CAS: 1255717-89-5

Versatile small molecule scaffold

Formula: C₆H₁₀ClN₃O₂

Purity: Min. 95%

Molecular weight: 191.61 g/mol

Ref: 3D-FAC71789