CAS 1255717-92-0

Cyclopropanamine, 1-cyclopentyl-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane and cyclopentane moieties, which contribute to its unique structural and functional properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amine functional group suggests potential basicity and reactivity, allowing for interactions with various biological targets. This compound may exhibit specific pharmacological activities, although detailed studies on its biological effects and mechanisms of action are necessary for a comprehensive understanding. Its molecular structure may influence its physical properties, such as melting point and boiling point, as well as its stability under different conditions. As with many amines, it may also participate in hydrogen bonding, affecting its solubility and reactivity. Overall, Cyclopropanamine, 1-cyclopentyl-, hydrochloride (1:1) represents a compound of interest in medicinal chemistry and related fields.

Formula: C₈H₁₆ClN

InChI: InChI=1S/C8H15N.ClH/c9-8(5-6-8)7-3-1-2-4-7;/h7H,1-6,9H2;1H

InChI key: InChIKey=SHBAMDDXOHPKQX-UHFFFAOYSA-N

SMILES: NC1(CC1)C2CCCC2.Cl

Synonyms:

• Cyclopropanamine, 1-cyclopentyl-, hydrochloride (1:1)
• 1-Cyclopentylcyclopropan-1-amine hydrochloride
• (1-Cyclopentylcyclopropyl)amine hydrochloride