CAS 1255717-94-2

3-Isoxazolemethanamine, 5-(2-furanyl)-, hydrochloride (1:1)

Description:

3-Isoxazolemethanamine, 5-(2-furanyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique isoxazole and furan functional groups. The isoxazole ring contributes to its potential biological activity, often associated with various pharmacological properties. The presence of the furan moiety can enhance the compound's reactivity and solubility, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, which is advantageous for formulation and biological studies. The compound's structure suggests potential applications in drug development, particularly in areas targeting neurological or inflammatory conditions, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further research into its pharmacodynamics and pharmacokinetics would be essential to fully understand its therapeutic potential and safety profile.

Formula: C₈H₈N₂O₂·ClH

InChI: InChI=1S/C8H8N2O2.ClH/c9-5-6-4-8(12-10-6)7-2-1-3-11-7;/h1-4H,5,9H2;1H

InChI key: InChIKey=GCLDRGQJQVUGHB-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(ON1)C2=CC=CO2.Cl

Synonyms:

• 3-Isoxazolemethanamine, 5-(2-furanyl)-, hydrochloride (1:1)

[5-(Fur-2-yl)isoxazol-3-yl]methylamine hydrochloride

CAS: 1255717-94-2

[5-(Fur-2-yl)isoxazol-3-yl]methylamine hydrochloride

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.62g/mol

Ref: 54-OR33648

{[5-(2-furyl)-3-isoxazolyl]methyl}amine hydrochloride

CAS: 1255717-94-2

Formula: C₈H₉ClN₂O₂

Purity: 95.0%

Molecular weight: 200.62

Ref: 10-F360020

[5-(Fur-2-yl)isoxazol-3-yl]methylamine hydrochloride

CAS: 1255717-94-2

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂·ClH

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-FAC71794