CAS 1255718-02-5

[1,3′-Bipyrrolidin]-4′-ol, hydrochloride (1:2), (3′R,4′R)-rel-

Description:

[1,3′-Bipyrrolidin]-4′-ol, hydrochloride (1:2), (3′R,4′R)-rel- is a chemical compound characterized by its bipyrrolidine structure, which consists of two pyrrolidine rings connected by a carbon-carbon bond. This compound features a hydroxyl group (-OH) at the 4' position, contributing to its potential as a chiral building block in organic synthesis. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The (3′R,4′R)-rel designation specifies the stereochemistry of the molecule, which is crucial for its biological activity and interaction with biological targets. Such compounds are often investigated for their potential therapeutic effects, particularly in the fields of neuroscience and medicinal chemistry. Overall, the unique structural and stereochemical properties of this substance make it a subject of interest for further research and development in drug discovery and synthesis.

Formula: C₈H₁₆N₂O·2ClH

InChI: InChI=1/C8H16N2O.2ClH/c11-8-6-9-5-7(8)10-3-1-2-4-10;;/h7-9,11H,1-6H2;2*1H/t7-,8-;;/s2

InChI key: InChIKey=ZEJMNWIUVPGSNL-KSSYWMKPNA-N

SMILES: O[C@H]1[C@@H](CNC1)N2CCCC2.Cl

Synonyms:

• [1,3′-Bipyrrolidin]-4′-ol, hydrochloride (1:2), (3′R,4′R)-rel-