CAS 1255718-03-6

1H-Imidazole-2-methanamine, N,5-dimethyl-, hydrochloride (1:2)

Description:

1H-Imidazole-2-methanamine, N,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methanamine group and two methyl substituents at the 5-position of the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water, making it suitable for various applications in biochemical and pharmaceutical contexts. The presence of the amine group suggests potential basicity, allowing it to participate in protonation reactions. This compound may exhibit biological activity, potentially acting as a ligand or a precursor in synthetic pathways. Its specific interactions and reactivity can be influenced by the imidazole moiety, which is known for its role in enzyme catalysis and coordination chemistry. Overall, this compound's structural features and properties make it of interest in medicinal chemistry and related fields.

Formula: C₆H₁₁N₃·2ClH

InChI: InChI=1S/C6H11N3.2ClH/c1-5-3-8-6(9-5)4-7-2;;/h3,7H,4H2,1-2H3,(H,8,9);2*1H

InChI key: InChIKey=PNEAAPUPUDIJKF-UHFFFAOYSA-N

SMILES: C(NC)C=1NC(C)=CN1.Cl

Synonyms:

• 1H-Imidazole-2-methanamine, N,5-dimethyl-, hydrochloride (1:2)

N-methyl-1-(4-methyl-1H-imidazol-2-yl)methanamine dihydrochloride

CAS: 1255718-03-6

Formula: C₆H₁₃Cl₂N₃

Purity: 95.0%

Molecular weight: 198.09

Ref: 10-F360941