CAS 1255718-04-7

4-Thiazolemethanamine, α,2,5-trimethyl-, hydrochloride (1:2)

Description:

4-Thiazolemethanamine, α,2,5-trimethyl-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its unique properties. This substance typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The thiazole moiety is known for its biological activity, often exhibiting antimicrobial and antifungal properties. The presence of the trimethyl groups enhances its lipophilicity, potentially influencing its interaction with biological membranes. As a hydrochloride salt, it is more stable and easier to handle compared to its free base form. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Thiazolemethanamine, α,2,5-trimethyl-, hydrochloride (1:2) represents a versatile compound with potential applications in medicinal chemistry.

Formula: C₇H₁₂N₂S·2ClH

InChI: InChI=1S/C7H12N2S.2ClH/c1-4(8)7-5(2)10-6(3)9-7;;/h4H,8H2,1-3H3;2*1H

InChI key: InChIKey=SBIWNHGRRGXRIO-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(C)SC1C.Cl

Synonyms:

• 4-Thiazolemethanamine, α,2,5-trimethyl-, hydrochloride (1:2)

[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]amine dihydrochloride

CAS: 1255718-04-7

Formula: C₇H₁₄Cl₂N₂S

Purity: 95.0%

Molecular weight: 229.16

Ref: 10-F360960