CAS 1255718-13-8

1H-Pyrazole-1-propanoic acid, hydrochloride (1:1)

Description:

1H-Pyrazole-1-propanoic acid, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often utilized in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of the propanoic acid moiety contributes to its potential as a building block in medicinal chemistry. Additionally, the compound may exhibit biological activity, making it of interest in the study of various therapeutic applications. As with many chemical substances, proper handling and safety precautions should be observed, as it may have specific toxicity or reactivity profiles. Overall, 1H-Pyrazole-1-propanoic acid, hydrochloride serves as a valuable compound in both academic and industrial settings.

Formula: C₆H₈N₂O₂·ClH

InChI: InChI=1S/C6H8N2O2.ClH/c9-6(10)2-5-8-4-1-3-7-8;/h1,3-4H,2,5H2,(H,9,10);1H

InChI key: InChIKey=YJNKXIAOMFBRCU-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C=CC=N1.Cl

Synonyms:

• 1H-Pyrazole-1-propanoic acid, hydrochloride (1:1)
• 3-(1H-Pyrazol-1-yl)propanoic acid hydrochloride

3-(1H-pyrazol-1-yl)propanoic acid hydrochloride

CAS: 1255718-13-8

Formula: C₆H₉ClN₂O₂

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 176.6

Ref: 10-F358847