CAS 1255718-14-9

2-Isoxazolidinepropanoic acid, hydrochloride (1:1)

Description:

2-Isoxazolidinepropanoic acid, hydrochloride (1:1) is a chemical compound characterized by its isoxazolidine ring structure, which contributes to its unique properties. This compound typically exhibits a white to off-white crystalline appearance and is soluble in water, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the hydrochloride salt form enhances its stability and solubility in aqueous solutions. As an amino acid derivative, it may participate in biological processes, potentially influencing metabolic pathways. The compound's molecular structure includes functional groups that can engage in hydrogen bonding, which may affect its reactivity and interaction with biological targets. Its specific stereochemistry can also play a crucial role in its biological activity and pharmacological profile. Overall, 2-Isoxazolidinepropanoic acid, hydrochloride is of interest in medicinal chemistry and research, particularly in the development of therapeutic agents. However, detailed studies on its biological effects and mechanisms of action are essential for a comprehensive understanding of its potential applications.

Formula: C₆H₁₁NO₃·ClH

InChI: InChI=1S/C6H11NO3.ClH/c8-6(9)2-4-7-3-1-5-10-7;/h1-5H2,(H,8,9);1H

InChI key: InChIKey=KGEJSCNOIGFANH-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1CCCO1.Cl

Synonyms:

• 2-Isoxazolidinepropanoic acid, hydrochloride (1:1)

3-(2-isoxazolidinyl)propanoic acid hydrochloride

CAS: 1255718-14-9

Formula: C₆H₁₂ClNO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 181.62

Ref: 10-F359263