CAS 1255718-18-3

4H-1,2,4-Triazole-3-methanamine, α-methyl-4-(1-methylethyl)-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, α-methyl-4-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential biological activity, including antifungal and antimicrobial effects. The presence of the α-methyl-4-(1-methylethyl) group suggests that it may have hydrophobic characteristics, influencing its solubility and interaction with biological membranes. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The compound's molecular structure indicates potential applications in pharmaceuticals, particularly in drug development, due to its ability to interact with various biological targets. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₇H₁₄N₄·2ClH

InChI: InChI=1S/C7H14N4.2ClH/c1-5(2)11-4-9-10-7(11)6(3)8;;/h4-6H,8H2,1-3H3;2*1H

InChI key: InChIKey=XRHWWCAVKZXXBK-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N(C(C)C)C=NN1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, α-methyl-4-(1-methylethyl)-, hydrochloride (1:2)

[1-(4-isopropyl-4H-1,2,4-triazol-3-yl)ethyl]amine dihydrochloride

CAS: 1255718-18-3

Formula: C₇H₁₆Cl₂N₄

Purity: 95.0%

Molecular weight: 227.13

Ref: 10-F359421