CAS 1255718-28-5

Cyclopropanamine, 1-propyl-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-propyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring, and an amine functional group. The presence of the propyl group indicates that there is a three-carbon alkyl chain attached to the nitrogen atom of the amine. As a hydrochloride salt, it is typically encountered in a solid form, where the amine is protonated by hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. Cyclopropanamine derivatives are of interest in medicinal chemistry due to their potential biological activities. However, specific applications and safety profiles would depend on further research and context regarding its use. As with all chemical substances, proper safety measures should be observed when handling this compound.

Formula: C₆H₁₃N·ClH

InChI: InChI=1S/C6H13N.ClH/c1-2-3-6(7)4-5-6;/h2-5,7H2,1H3;1H

InChI key: InChIKey=PNUTYZNAWCOUQX-UHFFFAOYSA-N

SMILES: C(CC)C1(N)CC1.Cl

Synonyms:

• 1-Propylcyclopropan-1-amine hydrochloride
• Cyclopropanamine, 1-propyl-, hydrochloride (1:1)

1-Propylcyclopropan-1-amine hydrochloride

CAS: 1255718-28-5

Versatile small molecule scaffold

Formula: C₆H₁₄ClN

Purity: Min. 95%

Molecular weight: 135.63 g/mol

Ref: 3D-FAC71828