CAS 125572-93-2: (6S)-6-(propyl-(2-thiophen-2-ylethyl)amino)tetralin-1-ol hydrochloride
Description:The chemical substance known as (6S)-6-(propyl-(2-thiophen-2-ylethyl)amino)tetralin-1-ol hydrochloride, with the CAS number 125572-93-2, is a synthetic compound that belongs to the class of tetralin derivatives. It features a tetralin core structure, which is a bicyclic compound consisting of a benzene ring fused to a cyclohexane ring. The presence of a propyl group and a thiophene moiety contributes to its unique chemical properties and potential biological activity. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the context of neuropharmacology or as a potential therapeutic agent. Its stereochemistry, indicated by the (6S) designation, suggests specific spatial arrangements of atoms that can influence its interaction with biological targets. Overall, this compound's structural features and functional groups are critical for its chemical behavior and potential applications in research and medicine.
Formula:C19H26ClNOS
InChI:InChI=1S/C19H25NOS.ClH/c1-2-11-20(12-10-17-6-4-13-22-17)16-8-9-18-15(14-16)5-3-7-19(18)21;/h3-7,13,16,21H,2,8-12,14H2,1H3;1H/t16-;/m0./s1
InChI key:InChIKey=CEXBONHIOKGWNU-NTISSMGPSA-N
SMILES:Cl.OC1=CC=CC2=C1CCC(N(CCC=3SC=CC3)CCC)C2
- Synonyms:
- (-)-5,6,7,8-Tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-1-naphthol hydrochloride
- (6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol hydrochloride
- (S)-5,6,7,8-Tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-1-naphthalenol hydrochloride
- 1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, hydrochloride (1:1), (6S)-
- 1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, hydrochloride, (6S)-
- 1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, hydrochloride, (S)-
- Rotigotine Hydrochloride