CAS 1255791-18-4

N-Hydroxy-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide

Description:

N-Hydroxy-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide is a chemical compound characterized by its unique structural features, which include a hydroxylamine functional group and a carboximidamide moiety. The presence of the 3-methyl-1,2,4-oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. This compound is likely to exhibit polar characteristics due to the hydroxyl and amide functionalities, which can influence its solubility and reactivity. Additionally, the methoxy group enhances its lipophilicity, potentially affecting its interaction with biological membranes. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and the potential for bioactivity. As with many chemical substances, its stability, reactivity, and biological effects would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₂N₄O₃

InChI: InChI=1S/C11H12N4O3/c1-7-13-10(18-15-7)6-17-9-4-2-3-8(5-9)11(12)14-16/h2-5,16H,6H2,1H3,(H2,12,14)

InChI key: InChIKey=WGIOQIKZVCRBGN-UHFFFAOYSA-N

SMILES: O(CC=1ON=C(C)N1)C2=CC(C(NO)=N)=CC=C2

Synonyms:

• Benzenecarboximidamide, N-hydroxy-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-
• N-Hydroxy-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide

(Z)-N’-hydroxy-3-((3-methyl-1,2,4-oxadiazol-5-yl)methoxy)benzimidamide

CAS: 1255791-18-4

Formula: C₁₁H₁₂N₄O₃

Purity: 95.0%

Molecular weight: 248.242

Ref: 10-F496159