CymitQuimica logo

CAS 1255794-74-1

:

2-Bromo-3-[(methoxymethoxy)methyl]benzaldehyde

Description:
2-Bromo-3-[(methoxymethoxy)methyl]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an aldehyde functional group. The presence of the bromine atom enhances its reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry. The methoxymethoxy group contributes to its solubility and can influence its electronic properties, potentially affecting its reactivity and interactions with biological targets. This compound is typically a pale yellow to light brown solid, and its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Additionally, the aldehyde group can participate in condensation reactions, while the methoxy groups can serve as protecting groups or participate in nucleophilic substitution reactions. Overall, 2-Bromo-3-[(methoxymethoxy)methyl]benzaldehyde is a versatile compound with applications in the development of pharmaceuticals and agrochemicals.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-13-7-14-6-9-4-2-3-8(5-12)10(9)11/h2-5H,6-7H2,1H3
InChI key:InChIKey=GJXSARHATOEALM-UHFFFAOYSA-N
SMILES:C(OCOC)C1=C(Br)C(C=O)=CC=C1
Synonyms:
  • 2-Bromo-3-[(methoxymethoxy)methyl]benzaldehyde
  • Benzaldehyde, 2-bromo-3-[(methoxymethoxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.