CAS 12558-49-5
:Ethylenediaminetetraaceticacidmonosodiumbismuthsalt
Description:
Ethylenediaminetetraacetic acid monosodium bismuth salt, with the CAS number 12558-49-5, is a complex chemical compound that features a bismuth ion coordinated with ethylenediaminetetraacetic acid (EDTA). This compound typically exhibits properties associated with both bismuth and EDTA, including chelation and potential therapeutic applications. It is often utilized in medical and pharmaceutical contexts, particularly for its role in enhancing the bioavailability of bismuth, which is known for its antimicrobial and gastroprotective properties. The presence of the sodium ion suggests that it is a salt form, which may influence its solubility and stability in various environments. Additionally, the chelating nature of EDTA allows this compound to bind metal ions, making it useful in various applications, including as a potential treatment for heavy metal toxicity. Overall, this compound combines the characteristics of a chelating agent with the unique properties of bismuth, making it valuable in both research and clinical settings.
Formula:C10H12BiN2NaO8
InChI:InChI=1/C10H16N2O8.Bi.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4
Synonyms:- Ethylenediaminetetraacetic Acid Monosodium Bismuth Salt
- Bismuth(3+) Sodium 2,2',2'',2'''-(Ethane-1,2-Diyldinitrilo)Tetraacetate (1:1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethylenediaminetetraacetic acid sodium bismuth
CAS:This is a nanorod photocathode that has a high efficiency and is nontoxic. It can be used as a source for the generation of hydrogen gas, which is an important fuel for vehicles. The efficiency of this reaction is repeatable and the process does not produce any toxic byproducts.Formula:C10H12BiN2NaO8Purity:Min. 95%Molecular weight:520.18 g/molBismuthate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, sodium (1:1), (OC-6-21)-
CAS:Formula:C10H12Bin2Nao8Molecular weight:520.1810 G/Mol


