CAS 1255859-41-6

(3S,4R)-4-Ethoxytetrahydro-3-furanamine

Description:

(3S,4R)-4-Ethoxytetrahydro-3-furanamine is a chiral organic compound characterized by its tetrahydrofuran ring structure, which incorporates an ethoxy group and an amine functional group. The stereochemistry indicated by the (3S,4R) notation suggests specific spatial arrangements of the atoms, which can significantly influence the compound's reactivity and interactions with biological systems. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can enhance its solubility in polar solvents. The presence of the ethoxy group may also contribute to its lipophilicity, affecting its pharmacokinetic properties if considered for pharmaceutical applications. Additionally, the furan ring can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Overall, the unique structural features of (3S,4R)-4-Ethoxytetrahydro-3-furanamine position it as a compound of interest in both synthetic chemistry and potential medicinal chemistry applications.

Formula: C₆H₁₃NO₂

InChI: InChI=1S/C6H13NO2/c1-2-9-6-4-8-3-5(6)7/h5-6H,2-4,7H2,1H3/t5-,6-/m0/s1

InChI key: InChIKey=DHKFYFFNUUVCHK-WDSKDSINSA-N

SMILES: O(CC)[C@@H]1[C@@H](N)COC1

Synonyms:

• (3S,4R)-4-Ethoxytetrahydro-3-furanamine
• 3-Furanamine, 4-ethoxytetrahydro-, (3S,4R)-