CAS 1255871-43-2

Cyclopropanecarboxylic acid, 1-(5-bromo-3-pyridinyl)-, potassium salt (1:1)

Description:

Cyclopropanecarboxylic acid, 1-(5-bromo-3-pyridinyl)-, potassium salt (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a bromine atom. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the presence of the potassium salt. The presence of the cyclopropanecarboxylic acid group suggests potential reactivity, particularly in organic synthesis and medicinal chemistry, where such compounds may exhibit biological activity. The bromine substitution on the pyridine ring can enhance the compound's reactivity and influence its pharmacological properties. As a potassium salt, it may also exhibit different solubility and stability characteristics compared to its acid form. Overall, this compound's unique structural features make it of interest in various chemical research applications, particularly in the development of new pharmaceuticals or agrochemicals.

Formula: C₉H₈BrNO₂·K

InChI: InChI=1S/C9H8BrNO2.K/c10-7-3-6(4-11-5-7)9(1-2-9)8(12)13;/h3-5H,1-2H2,(H,12,13);

InChI key: InChIKey=UTWMUFFIOBGHPV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C=2C=C(Br)C=NC2.[K]

Synonyms:

• Cyclopropanecarboxylic acid, 1-(5-bromo-3-pyridinyl)-, potassium salt (1:1)