CAS 1255939-60-6

4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde

Description:

4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a chloro substituent at the 4-position and a methyl group at the 5-position contributes to its unique reactivity and potential biological activity. The aldehyde functional group at the 7-position is significant for its reactivity, allowing for various chemical transformations, including condensation reactions and nucleophilic additions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, which is crucial for its application in research and development. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Overall, 4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde represents a valuable scaffold in organic synthesis and drug discovery.

Formula: C₈H₆ClN₃O

InChI: InChI=1S/C8H6ClN3O/c1-12-2-5(3-13)6-7(12)8(9)11-4-10-6/h2-4H,1H3

InChI key: InChIKey=ARUMSGJVFWJPHW-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(N(C)C1)=C(Cl)N=CN2

Synonyms:

• 5H-Pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde, 4-chloro-5-methyl-
• 4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxaldehyde

4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carbaldehyde

CAS: 1255939-60-6

Formula: C₈H₆ClN₃O

Molecular weight: 195.6057

Ref: IN-DA000NX1