CymitQuimica logo

CAS 125602-70-2

:

ethyl 4-{4-[(4-chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoate 4-methylbenzenesulfonate

Description:
Ethyl 4-{4-[(4-chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoate 4-methylbenzenesulfonate, with CAS number 125602-70-2, is a complex organic compound characterized by its multi-functional structure. It features an ethyl ester group, a piperidine ring, and a pyridine moiety, which contribute to its potential biological activity. The presence of a 4-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, possibly influencing its pharmacological properties. The sulfonate group enhances its solubility in polar solvents, which can be advantageous for formulation in pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric conditions, given the structural motifs associated with such activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and potential applications would be explored through various analytical methods. As with any chemical substance, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C30H37ClN2O6S
InChI:InChI=1/C23H29ClN2O3.C7H8O3S/c1-2-28-22(27)7-5-15-26-16-12-20(13-17-26)29-23(21-6-3-4-14-25-21)18-8-10-19(24)11-9-18;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,6,8-11,14,20,23H,2,5,7,12-13,15-17H2,1H3;2-5H,1H3,(H,8,9,10)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.