
CAS 125607-06-9
:2-(3,6,9,12-Tetraoxapentadec-14-en-1-yl)-1H-isoindole-1,3(2H)-dione
Description:
2-(3,6,9,12-Tetraoxapentadec-14-en-1-yl)-1H-isoindole-1,3(2H)-dione, with CAS number 125607-06-9, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole moiety and a long aliphatic chain containing multiple ether linkages. This compound features a unique arrangement of functional groups, including a dione, which contributes to its reactivity and potential applications in various fields such as materials science and medicinal chemistry. The presence of the tetraoxapentadecene chain suggests that it may exhibit interesting physical properties, such as solubility in organic solvents and potential amphiphilic behavior. Its structural features may also impart specific biological activities, making it a candidate for further research in drug development or as a biochemical probe. Overall, the compound's unique characteristics stem from its intricate structure, which combines elements of both aromatic and aliphatic chemistry, leading to diverse potential applications.
Formula:C19H25NO6
InChI:InChI=1S/C19H25NO6/c1-2-8-23-10-12-25-14-15-26-13-11-24-9-7-20-18(21)16-5-3-4-6-17(16)19(20)22/h2-6H,1,7-15H2
InChI key:InChIKey=AKDWINLZOSZSOJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCOCCOCCOCCOCC=C)=CC=CC2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-(3,6,9,12-tetraoxapentadec-14-en-1-yl)-
- 2-(3,6,9,12-Tetraoxapentadec-14-en-1-yl)-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Isoindole-1,3(2H)-dione, 2-(3,6,9,12-tetraoxapentadec-14-en-1-yl)-
CAS:Formula:C19H25NO6Molecular weight:363.4049
