CAS 1256255-23-8

8-Chloro-3,4-dihydro-2H-1-benzopyran-7-ol

Description:

8-Chloro-3,4-dihydro-2H-1-benzopyran-7-ol is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a chlorine atom at the 8-position and a hydroxyl group at the 7-position, contributing to its reactivity and potential biological activity. The presence of the dihydro group indicates that it has a saturated ring system, which can influence its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the chlorine substituent may enhance lipophilicity, affecting the compound's absorption and distribution in biological systems. Overall, 8-Chloro-3,4-dihydro-2H-1-benzopyran-7-ol represents a class of compounds that could be explored for their therapeutic potential, although specific biological data would be necessary to fully understand its characteristics and applications.

Formula: C₉H₉ClO₂

InChI: InChI=1S/C9H9ClO2/c10-8-7(11)4-3-6-2-1-5-12-9(6)8/h3-4,11H,1-2,5H2

InChI key: InChIKey=YREPPJPXCAKZKN-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC=C1O)CCCO2

Synonyms:

• 2H-1-Benzopyran-7-ol, 8-chloro-3,4-dihydro-
• 8-Chloro-3,4-dihydro-2H-1-benzopyran-7-ol