CAS 1256264-87-5

1H-Pyrazole-1-acetic acid, 4-amino-, hydrazide, hydrochloride (1:1)

Description:

1H-Pyrazole-1-acetic acid, 4-amino-, hydrazide, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an acetic acid moiety and an amino group, contributing to its potential biological activity. The hydrazide functional group indicates the presence of a hydrazine derivative, which can participate in various chemical reactions, including condensation and hydrazone formation. The hydrochloride salt form enhances its solubility in water, making it suitable for various applications, particularly in pharmaceutical research. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further studies. Its CAS number, 1256264-87-5, allows for precise identification in chemical databases. As with many hydrazides, it is essential to handle this compound with care due to potential toxicity and reactivity, particularly in the presence of strong oxidizing agents.

Formula: C₅H₉N₅O·ClH

InChI: InChI=1S/C5H9N5O.ClH/c6-4-1-8-10(2-4)3-5(11)9-7;/h1-2H,3,6-7H2,(H,9,11);1H

InChI key: InChIKey=OILOWNBXINQTLC-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C=C(N)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-amino-, hydrazide, hydrochloride (1:1)