CAS 125631-33-6

PENT-4-ENYL-D-GLUCOPYRANOSIDE

Description:

Pent-4-enyl-D-glucopyranoside is a glycoside derived from D-glucose, characterized by the presence of a pent-4-enyl group attached to the anomeric carbon of the glucose moiety. This compound features a six-membered pyranose ring structure typical of glucose, which contributes to its stability and solubility in polar solvents. The pent-4-enyl group introduces a double bond, providing unique reactivity and potential for further chemical modifications. This compound is of interest in various fields, including organic synthesis and biochemistry, due to its potential applications in the development of glycosylated compounds and as a building block in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of the double bond may influence its reactivity in chemical reactions, making it a valuable intermediate in synthetic organic chemistry. Overall, pent-4-enyl-D-glucopyranoside represents a versatile compound with significant implications in research and industry.

Formula: C₁₁H₂₀O₆

InChI: InChI=1/C11H20O6/c1-2-3-4-5-16-11-10(15)9(14)8(13)7(6-12)17-11/h2,7-15H,1,3-6H2/t7-,8-,9+,10-,11u/m1/s1

Synonyms:

• pent-4-en-1-yl D-glucopyranoside

Pent-4-enyl-D-glucopyranoside

CAS: 125631-33-6

Pent-4-enyl-D-glucopyranoside is a kind of compound that reacts with acetonitrile to form sodium methoxide. The reaction of the sodium methoxide with the acetonitrile will produce 2-chlorobenzoic acid and conformation. The result of this reaction is the stereospecifically, which is a pyranose ring.

Formula: C₁₁H₂₀O₆

Purity: Min. 95%

Molecular weight: 248.27 g/mol

Ref: 3D-MP150983