CAS 1256345-48-8

B-[3-Chloro-5-(2-methylpropoxy)phenyl]boronic acid

Description:

B-[3-Chloro-5-(2-methylpropoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which can influence its reactivity and solubility, as well as a branched alkoxy group that enhances its lipophilicity. This structure allows for potential interactions in biological systems, making it a candidate for drug development or as a reagent in cross-coupling reactions, such as Suzuki-Miyaura coupling. The presence of the boronic acid moiety also suggests potential applications in sensor technology and materials science. Overall, the unique combination of functional groups in this compound contributes to its versatility in chemical reactions and biological applications.

Formula: C₁₀H₁₄BClO₃

InChI: InChI=1S/C10H14BClO3/c1-7(2)6-15-10-4-8(11(13)14)3-9(12)5-10/h3-5,7,13-14H,6H2,1-2H3

InChI key: InChIKey=CGTOXTWGSICCOL-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=CC(B(O)O)=CC(Cl)=C1

Synonyms:

• Boronic acid, B-[3-chloro-5-(2-methylpropoxy)phenyl]-
• B-[3-Chloro-5-(2-methylpropoxy)phenyl]boronic acid

Boronic acid, B-[3-chloro-5-(2-methylpropoxy)phenyl]-

CAS: 1256345-48-8

Formula: C₁₀H₁₄BClO₃

Molecular weight: 228.4804

Ref: IN-DA000NZ3

3-Chloro-5-isobutoxyphenylboronic acid

CAS: 1256345-48-8

3-Chloro-5-isobutoxyphenylboronic acid

Purity: ≥95%

Molecular weight: 228.48g/mol

Ref: 54-OR360512