CAS 1256345-54-6

B-[2-[(2-Methylpropyl)thio]-5-(trifluoromethyl)-3-pyridinyl]boronic acid

Description:

B-[2-[(2-Methylpropyl)thio]-5-(trifluoromethyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a pyridine ring substituted with a trifluoromethyl group, enhancing its electronic properties and potentially increasing its lipophilicity. The presence of a thioether group, specifically a 2-methylpropyl thio substituent, contributes to its unique reactivity and solubility characteristics. Boronic acids are often utilized in organic synthesis, particularly in Suzuki coupling reactions, making this compound potentially valuable in pharmaceutical and materials chemistry. Additionally, the trifluoromethyl group can impart distinct biological activity, influencing the compound's interaction with biological targets. Overall, this compound's structural features suggest it may have applications in drug development and chemical synthesis, although specific biological or chemical properties would require further investigation.

Formula: C₁₀H₁₃BF₃NO₂S

InChI: InChI=1S/C10H13BF3NO2S/c1-6(2)5-18-9-8(11(16)17)3-7(4-15-9)10(12,13)14/h3-4,6,16-17H,5H2,1-2H3

InChI key: InChIKey=NCDFXUYMQWCKCA-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(SCC(C)C)N=CC(C(F)(F)F)=C1

Synonyms:

• Boronic acid, B-[2-[(2-methylpropyl)thio]-5-(trifluoromethyl)-3-pyridinyl]-
• B-[2-[(2-Methylpropyl)thio]-5-(trifluoromethyl)-3-pyridinyl]boronic acid

2-Isobutylthio-5-trifluoromethylpyridine-3-boronic acid

CAS: 1256345-54-6

Formula: C₁₀H₁₃BF₃NO₂S

Molecular weight: 279.0869

Ref: IN-DA000O0B