CymitQuimica logo

CAS 1256345-57-9

:

B-(2-Chloro-3-ethoxyphenyl)boronic acid

Description:
B-(2-Chloro-3-ethoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a chloro and an ethoxy group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the chloro and ethoxy substituents can influence its reactivity and solubility, potentially enhancing its utility in drug development and material science. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and as intermediates in the synthesis of more complex molecules. Overall, B-(2-Chloro-3-ethoxyphenyl)boronic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C8H10BClO3
InChI:InChI=1S/C8H10BClO3/c1-2-13-7-5-3-4-6(8(7)10)9(11)12/h3-5,11-12H,2H2,1H3
InChI key:InChIKey=LEKFCKITYLGIAS-UHFFFAOYSA-N
SMILES:O(CC)C1=C(Cl)C(B(O)O)=CC=C1
Synonyms:
  • 2-Chloro-3-ethoxyphenylboronic acid
  • B-(2-Chloro-3-ethoxyphenyl)boronic acid
  • Boronic acid, B-(2-chloro-3-ethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.