CAS 1256345-80-8

B-(3-Butoxy-5-methylphenyl)boronic acid

Description:

B-(3-Butoxy-5-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. The presence of the butoxy and methyl substituents on the phenyl ring can influence the compound's reactivity and solubility, making it useful in medicinal chemistry and materials science. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. Safety data sheets should be consulted for handling and storage guidelines, as boronic acids can be sensitive to moisture and may require specific conditions to maintain stability.

Formula: C₁₁H₁₇BO₃

InChI: InChI=1S/C11H17BO3/c1-3-4-5-15-11-7-9(2)6-10(8-11)12(13)14/h6-8,13-14H,3-5H2,1-2H3

InChI key: InChIKey=VTFQPBYXHPOAHC-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(OCCCC)=CC(C)=C1

Synonyms:

• B-(3-Butoxy-5-methylphenyl)boronic acid
• Boronic acid, B-(3-butoxy-5-methylphenyl)-

Boronic acid, B-(3-butoxy-5-methylphenyl)-

CAS: 1256345-80-8

Formula: C₁₁H₁₇BO₃

Purity: 98%

Molecular weight: 208.0619

Ref: IN-DA000O0Z

3-Butoxy-5-methylphenylboronic acid

CAS: 1256345-80-8

3-Butoxy-5-methylphenylboronic acid

Purity: ≥95%

Molecular weight: 208.06g/mol

Ref: 54-OR360832

(3-Butoxy-5-methylphenyl)boronic acid

CAS: 1256345-80-8

Formula: C₁₁H₁₇BO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 208.06

Ref: 10-F228579