CAS 1256346-29-8

B-[4-(3-Methyl-1-oxobutyl)phenyl]boronic acid

Description:

B-[4-(3-Methyl-1-oxobutyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a 3-methyl-1-oxobutyl group, contributing to its unique chemical properties. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and materials science. Additionally, the presence of the ketone group in the side chain may influence its reactivity and solubility in different solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of boronic acids to interact with biological targets. Overall, B-[4-(3-Methyl-1-oxobutyl)phenyl]boronic acid is a versatile compound with notable characteristics that make it valuable in both synthetic and biological contexts.

Formula: C₁₁H₁₅BO₃

InChI: InChI=1S/C11H15BO3/c1-8(2)7-11(13)9-3-5-10(6-4-9)12(14)15/h3-6,8,14-15H,7H2,1-2H3

InChI key: InChIKey=HFIQYDWQIGRTGC-UHFFFAOYSA-N

SMILES: C(CC(C)C)(=O)C1=CC=C(B(O)O)C=C1

Synonyms:

• B-[4-(3-Methyl-1-oxobutyl)phenyl]boronic acid
• Boronic acid, B-[4-(3-methyl-1-oxobutyl)phenyl]-

4-(3-Methylbutanoyl)phenylboronic acid

CAS: 1256346-29-8

Formula: C₁₁H₁₅BO₃

Molecular weight: 206.0460

Ref: IN-DA000O16