CAS 1256346-30-1

B-[4-(Cyclohexylcarbonyl)phenyl]boronic acid

Description:

B-[4-(Cyclohexylcarbonyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyclohexylcarbonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity with various electrophiles due to the boronic acid moiety, which can participate in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. The cyclohexylcarbonyl group contributes to the compound's hydrophobic characteristics and may influence its biological activity and interactions with other molecules. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be utilized in sensing applications. Overall, B-[4-(Cyclohexylcarbonyl)phenyl]boronic acid is of interest in both synthetic organic chemistry and materials science, particularly in the development of pharmaceuticals and advanced materials.

Formula: C₁₃H₁₇BO₃

InChI: InChI=1S/C13H17BO3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h6-10,16-17H,1-5H2

InChI key: InChIKey=NOGXTZOSEOYJPK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(B(O)O)C=C1)C2CCCCC2

Synonyms:

• Boronic acid, B-[4-(cyclohexylcarbonyl)phenyl]-
• B-[4-(Cyclohexylcarbonyl)phenyl]boronic acid

4-(Cyclohexanecarbonyl)phenylboronic acid

CAS: 1256346-30-1

Formula: C₁₃H₁₇BO₃

Molecular weight: 232.0833

Ref: IN-DA000O15