CAS 1256346-37-8

B-[4-Chloro-3-(2-methylpropoxy)phenyl]boronic acid

Description:

B-[4-Chloro-3-(2-methylpropoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which can influence its reactivity and solubility. The presence of the 2-methylpropoxy group enhances its lipophilicity, potentially improving its bioavailability in pharmaceutical contexts. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the specific structural features of this compound may impart unique properties, such as selective binding to certain biological targets or enhanced stability under various conditions. Overall, B-[4-Chloro-3-(2-methylpropoxy)phenyl]boronic acid exemplifies the diverse functionality of boron-containing compounds in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₄BClO₃

InChI: InChI=1S/C10H14BClO3/c1-7(2)6-15-10-5-8(11(13)14)3-4-9(10)12/h3-5,7,13-14H,6H2,1-2H3

InChI key: InChIKey=HMVMYENCQOGANR-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=CC(B(O)O)=CC=C1Cl

Synonyms:

• B-[4-Chloro-3-(2-methylpropoxy)phenyl]boronic acid
• Boronic acid, B-[4-chloro-3-(2-methylpropoxy)phenyl]-
• 4-Chloro-3-isobutoxyphenylboronic acid

4-Chloro-3-isobutoxyphenylboronic acid

CAS: 1256346-37-8

Formula: C₁₀H₁₄BClO₃

Molecular weight: 228.4804

Ref: IN-DA000O2B

4-Chloro-3-isobutoxyphenylboronic acid

CAS: 1256346-37-8

4-Chloro-3-isobutoxyphenylboronic acid

Purity: ≥95%

Molecular weight: 228.48g/mol

Ref: 54-OR360524