CymitQuimica logo

CAS 1256354-92-3

:

B-[2-Fluoro-5-(1-methylethyl)phenyl]boronic acid

Description:
B-[2-Fluoro-5-(1-methylethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic synthesis applications, particularly in Suzuki coupling reactions. This compound features a fluorinated phenyl ring, which enhances its electronic properties and can influence its reactivity and solubility. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to its steric bulk, potentially affecting its interactions with other molecules. Boronic acids are typically polar and can form reversible complexes with diols, making them useful in the development of sensors and in medicinal chemistry for drug design. The fluorine atom can also impart unique characteristics, such as increased lipophilicity and altered metabolic stability. Overall, B-[2-Fluoro-5-(1-methylethyl)phenyl]boronic acid is a versatile compound with applications in synthetic organic chemistry and materials science.
Formula:C9H12BFO2
InChI:InChI=1S/C9H12BFO2/c1-6(2)7-3-4-9(11)8(5-7)10(12)13/h3-6,12-13H,1-2H3
InChI key:InChIKey=YXCUUQOHGRSVQC-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C(C)C)=CC=C1F
Synonyms:
  • (2-Fluoro-5-isopropylphenyl)boronic acid
  • Boronic acid, B-[2-fluoro-5-(1-methylethyl)phenyl]-
  • B-[2-Fluoro-5-(1-methylethyl)phenyl]boronic acid
  • [2-Fluoro-5-(propan-2-yl)phenyl]boronic acid
  • 2-Fluoro-5-isopropylphenylboronic acid
Found 4 products.