CAS 1256355-04-0

B-[4-Chloro-2-(1-methylethoxy)phenyl]boronic acid

Description:

B-[4-Chloro-2-(1-methylethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which can influence its reactivity and solubility. The presence of the 1-methylethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with other molecules. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the compound may exhibit properties such as moderate stability under ambient conditions, but it can be sensitive to moisture and air, necessitating careful handling and storage. Overall, B-[4-Chloro-2-(1-methylethoxy)phenyl]boronic acid is a versatile compound with significant implications in synthetic organic chemistry and pharmaceutical development.

Formula: C₉H₁₂BClO₃

InChI: InChI=1S/C9H12BClO3/c1-6(2)14-9-5-7(11)3-4-8(9)10(12)13/h3-6,12-13H,1-2H3

InChI key: InChIKey=YIGSWKJVDNWHFS-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(OC(C)C)C=C(Cl)C=C1

Synonyms:

• B-[4-Chloro-2-(1-methylethoxy)phenyl]boronic acid
• (4-Chloro-2-isopropoxyphenyl)boronic acid
• Boronic acid, B-[4-chloro-2-(1-methylethoxy)phenyl]-

Boronic acid, B-[4-chloro-2-(1-methylethoxy)phenyl]-

CAS: 1256355-04-0

Formula: C₉H₁₂BClO₃

Purity: 95%

Molecular weight: 214.4538

Ref: IN-DA000O2Q

4-Chloro-2-isopropoxyphenylboronic acid

CAS: 1256355-04-0

4-Chloro-2-isopropoxyphenylboronic acid

Purity: ≥95%

Molecular weight: 214.45g/mol

Ref: 54-OR360534

(4-Chloro-2-isopropoxyphenyl)boronic acid

CAS: 1256355-04-0

Formula: C₉H₁₂BClO₃

Purity: ≥95%

Molecular weight: 214.45

Ref: 10-F228612