CymitQuimica logo

CAS 1256355-09-5

:

B-(6-Methyl-8-quinolinyl)boronic acid

Description:
B-(6-Methyl-8-quinolinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a quinoline derivative. This compound typically exhibits properties associated with both boronic acids and quinoline derivatives, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the methyl group at the 6-position of the quinoline ring can influence its solubility and reactivity. Additionally, the boronic acid moiety allows for participation in Suzuki coupling reactions, which are valuable in the synthesis of complex organic molecules. The compound may also exhibit biological activity, potentially serving as a scaffold for drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular structure and the surrounding environment. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions to maintain stability.
Formula:C10H10BNO2
InChI:InChI=1S/C10H10BNO2/c1-7-5-8-3-2-4-12-10(8)9(6-7)11(13)14/h2-6,13-14H,1H3
InChI key:InChIKey=SGPCPGDEXRWIEN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C2=C(C=C(C)C1)C=CC=N2
Synonyms:
  • Boronic acid, B-(6-methyl-8-quinolinyl)-
  • B-(6-Methyl-8-quinolinyl)boronic acid
  • 6-Methylquinoline-8-boronic acid
  • (6-Methylquinolin-8-yl)boronic acid
Found 4 products.