CAS 1256355-17-5

B-[1-(Boronophenylmethyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(Boronophenylmethyl)-1H-pyrazol-4-yl]boronic acid is a boronic acid derivative characterized by its unique structure, which includes a pyrazole ring and a boron-containing phenyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyrazole moiety may impart specific biological activities, potentially making it a candidate for drug development or as a biochemical probe. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are essential in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility, stability, and reactivity can vary based on its environment, including pH and the presence of other functional groups. Overall, B-[1-(Boronophenylmethyl)-1H-pyrazol-4-yl]boronic acid represents a versatile building block in the field of organic chemistry and materials science.

Formula: C₁₀H₁₂B₂N₂O₄

InChI: InChI=1S/C10H12B2N2O4/c15-11(16)9-6-13-14(7-9)10(12(17)18)8-4-2-1-3-5-8/h1-7,10,15-18H

InChI key: InChIKey=ABNQSLSZKRNDNJ-UHFFFAOYSA-N

SMILES: C(B(O)O)(N1C=C(B(O)O)C=N1)C2=CC=CC=C2

Synonyms:

• Boronic acid, B-[1-(boronophenylmethyl)-1H-pyrazol-4-yl]-
• B-[1-(Boronophenylmethyl)-1H-pyrazol-4-yl]boronic acid
• 1-(1-Borono-1-phenylmethyl)pyrazole-4-boronic acid
• 1-(1-Borono-1-phenylmethyl)-1H-pyrazole-4-boronic acid

1-(1-Borono-1-phenylmethyl)pyrazole-4-boronic acid

CAS: 1256355-17-5

Formula: C₁₀H₁₂B₂N₂O₄

Molecular weight: 245.8353

Ref: IN-DA000O3R

1-(1-Borono-1-phenylmethyl)pyrazole-4-boronic acid

CAS: 1256355-17-5

1-(1-Borono-1-phenylmethyl)pyrazole-4-boronic acid

Purity: ≥95%

Molecular weight: 245.84g/mol

Ref: 54-OR360763