CymitQuimica logo

CAS 1256355-41-5

:

1-Methyl 2-borono-6-methoxybenzoate

Description:
1-Methyl 2-borono-6-methoxybenzoate is an organic compound characterized by the presence of a boron atom, which is typically involved in various chemical reactions, particularly in organic synthesis and catalysis. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a benzoate structure, which contributes to its aromatic properties. The boron atom is likely to be involved in forming boronate esters, making it useful in cross-coupling reactions, such as Suzuki coupling, which is significant in the synthesis of complex organic molecules. The methoxy group can influence the compound's reactivity and solubility, while the overall structure suggests potential applications in medicinal chemistry and materials science. Additionally, the presence of the boron atom may enhance the compound's ability to participate in various chemical transformations, making it a valuable intermediate in synthetic pathways. As with many boron-containing compounds, it may exhibit unique properties such as Lewis acidity, which can be exploited in various chemical applications.
Formula:C9H11BO5
InChI:InChI=1S/C9H11BO5/c1-14-7-5-3-4-6(10(12)13)8(7)9(11)15-2/h3-5,12-13H,1-2H3
InChI key:InChIKey=AEICUNBBGBPHDP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(B(O)O)C=CC=C1OC
Synonyms:
  • Benzoic acid, 2-borono-6-methoxy-, 1-methyl ester
  • 2-Methoxycarbonyl-3-methoxylphenylboronic acid
  • 2-Methoxycarbonyl-3-methoxyphenylboronic acid
  • [3-Methoxy-2-(methoxycarbonyl)phenyl]boronic acid
  • 1-Methyl 2-borono-6-methoxybenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.