CAS 1256355-54-0

B-[2-(Methoxymethoxy)-5-(trifluoromethyl)phenyl]boronic acid

Description:

B-[2-(Methoxymethoxy)-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a trifluoromethyl group, which enhances its lipophilicity and can influence its electronic properties. The methoxymethoxy substituent contributes to its solubility and reactivity, allowing for potential applications in cross-coupling reactions, such as Suzuki-Miyaura coupling. The presence of the boronic acid moiety also makes it a candidate for use in drug development, particularly in the design of inhibitors targeting specific biological pathways. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their role in the development of pharmaceuticals.

Formula: C₉H₁₀BF₃O₄

InChI: InChI=1S/C9H10BF3O4/c1-16-5-17-8-3-2-6(9(11,12)13)4-7(8)10(14)15/h2-4,14-15H,5H2,1H3

InChI key: InChIKey=FHAJNPDIFPNNSA-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(OCOC)C=CC(C(F)(F)F)=C1

Synonyms:

• Boronic acid, B-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]-
• B-[2-(Methoxymethoxy)-5-(trifluoromethyl)phenyl]boronic acid

Boronic acid, B-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]-

CAS: 1256355-54-0

Formula: C₉H₁₀BF₃O₄

Purity: 95%

Molecular weight: 249.9795

Ref: IN-DA000O45

2-Methoxymethoxy-5-(trifluoromethyl)phenylboronic acid

CAS: 1256355-54-0

2-Methoxymethoxy-5-(trifluoromethyl)phenylboronic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 249.98g/mol

Ref: 54-PC412064

(2-(Methoxymethoxy)-5-(trifluoromethyl)phenyl)boronic acid

CAS: 1256355-54-0

Purity: ≥95%

Molecular weight: 249.9799957

Ref: 10-F694295