CAS 1256355-66-4
:B-[2-[(4-Cyanophenyl)methoxy]phenyl]boronic acid
Description:
B-[2-[(4-Cyanophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a methoxy group and a cyanophenyl moiety, contributing to its unique electronic properties and potential reactivity. The presence of the cyanophenyl group may enhance its solubility and interaction with biological targets, making it of interest in drug development. Additionally, boronic acids are often utilized in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structural characteristics suggest potential applications in materials science, particularly in the development of sensors or catalysts. Overall, B-[2-[(4-Cyanophenyl)methoxy]phenyl]boronic acid exemplifies the versatility of boron-containing compounds in both synthetic and applied chemistry contexts.
Formula:C14H12BNO3
InChI:InChI=1S/C14H12BNO3/c16-9-11-5-7-12(8-6-11)10-19-14-4-2-1-3-13(14)15(17)18/h1-8,17-18H,10H2
InChI key:InChIKey=IYHPJZAWRHJSBH-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(C#N)C=C1)C2=C(B(O)O)C=CC=C2
Synonyms:- Boronic acid, B-[2-[(4-cyanophenyl)methoxy]phenyl]-
- B-[2-[(4-Cyanophenyl)methoxy]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
