CAS 1256355-74-4
:B-[5-Fluoro-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid
Description:
B-[5-Fluoro-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid, with the CAS number 1256355-74-4, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with fluorine and a methoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity. Additionally, the methoxy group can affect the compound's solubility and reactivity. As a boronic acid, it may also participate in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's unique structure and functional groups contribute to its potential utility in pharmaceutical development and material science.
Formula:C13H11BF2O3
InChI:InChI=1S/C13H11BF2O3/c15-10-3-1-9(2-4-10)8-19-13-6-5-11(16)7-12(13)14(17)18/h1-7,17-18H,8H2
InChI key:InChIKey=GXCALMDRDMRRDL-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=C(B(O)O)C=C(F)C=C2
Synonyms:- B-[5-Fluoro-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid
- Boronic acid, B-[5-fluoro-2-[(4-fluorophenyl)methoxy]phenyl]-
- 5-Fluoro-2-(4-fluorophenylmethoxy)phenylboronic acid
- (5-Fluoro-2-((4-fluorobenzyl)oxy)phenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Fluoro-2-(4-fluorophenylmethoxy)phenylboronic acid
CAS:Formula:C13H11BF2O3Molecular weight:264.0324
