CymitQuimica logo

CAS 1256355-76-6

:

B-[4-[(2,3-Difluorophenyl)methoxy]phenyl]boronic acid

Description:
B-[4-[(2,3-Difluorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which typically exhibits properties such as Lewis acidity and the ability to form reversible covalent bonds with diols. This compound features a biphenyl structure with a methoxy group and a difluorophenyl substituent, contributing to its potential applications in medicinal chemistry and materials science. The difluorophenyl moiety may enhance lipophilicity and influence biological activity, while the boronic acid group is known for its role in Suzuki coupling reactions, making it valuable in organic synthesis. Additionally, boronic acids can act as sensors for glucose and other biomolecules due to their ability to form complexes with hydroxyl-containing compounds. The compound's solubility, stability, and reactivity can vary based on the surrounding environment, including pH and solvent polarity. Overall, B-[4-[(2,3-Difluorophenyl)methoxy]phenyl]boronic acid is a versatile compound with significant implications in various chemical and pharmaceutical applications.
Formula:C13H11BF2O3
InChI:InChI=1S/C13H11BF2O3/c15-12-3-1-2-9(13(12)16)8-19-11-6-4-10(5-7-11)14(17)18/h1-7,17-18H,8H2
InChI key:InChIKey=IGHRKMDUIARIJF-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(B(O)O)C=C1)C2=C(F)C(F)=CC=C2
Synonyms:
  • B-[4-[(2,3-Difluorophenyl)methoxy]phenyl]boronic acid
  • Boronic acid, B-[4-[(2,3-difluorophenyl)methoxy]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.