CymitQuimica logo

CAS 1256355-78-8

:

B-[4-[(3-Cyanophenyl)methoxy]phenyl]boronic acid

Description:
B-[4-[(3-Cyanophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a methoxy group and a cyanophenyl moiety, contributing to its potential reactivity and solubility properties. Boronic acids are typically polar and can engage in hydrogen bonding due to the presence of the hydroxyl group, which enhances their solubility in polar solvents. This compound may exhibit interesting electronic properties due to the presence of the electron-withdrawing cyano group, which can influence its reactivity and interactions in chemical reactions. Additionally, boronic acids are often utilized in Suzuki coupling reactions, making this compound potentially valuable in the synthesis of complex organic molecules. Its specific characteristics, such as melting point, solubility, and reactivity, would need to be determined through experimental data.
Formula:C14H12BNO3
InChI:InChI=1S/C14H12BNO3/c16-9-11-2-1-3-12(8-11)10-19-14-6-4-13(5-7-14)15(17)18/h1-8,17-18H,10H2
InChI key:InChIKey=WXDTXGCOBVDLQR-UHFFFAOYSA-N
SMILES:O(CC1=CC(C#N)=CC=C1)C2=CC=C(B(O)O)C=C2
Synonyms:
  • Boronic acid, B-[4-[(3-cyanophenyl)methoxy]phenyl]-
  • B-[4-[(3-Cyanophenyl)methoxy]phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.