CAS 1256355-79-9

B-[3-[(2-Cyanophenyl)methoxy]phenyl]boronic acid

Description:

B-[3-[(2-Cyanophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a methoxy group and a cyanophenyl moiety, contributing to its potential reactivity and solubility properties. Boronic acids are often utilized in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Additionally, the presence of the cyanophenyl group may impart unique electronic properties, influencing the compound's behavior in biological systems or as a ligand in coordination chemistry. The compound's structure suggests it may exhibit moderate to high polarity, affecting its solubility in different solvents. Overall, B-[3-[(2-Cyanophenyl)methoxy]phenyl]boronic acid is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₄H₁₂BNO₃

InChI: InChI=1S/C14H12BNO3/c16-9-11-4-1-2-5-12(11)10-19-14-7-3-6-13(8-14)15(17)18/h1-8,17-18H,10H2

InChI key: InChIKey=DXKOXHWUUJRLHR-UHFFFAOYSA-N

SMILES: C(OC1=CC(B(O)O)=CC=C1)C2=C(C#N)C=CC=C2

Synonyms:

• B-[3-[(2-Cyanophenyl)methoxy]phenyl]boronic acid
• Boronic acid, B-[3-[(2-cyanophenyl)methoxy]phenyl]-

3-(2-Cyanophenylmethoxy)phenylboronic acid

CAS: 1256355-79-9

Formula: C₁₄H₁₂BNO₃

Molecular weight: 253.0610

Ref: IN-DA000O4U