CAS 1256355-82-4
:B-[2-[(3-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid
Description:
B-[2-[(3-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a boron atom bonded to a phenyl ring that is substituted with a methoxy group and a fluorophenyl moiety, contributing to its unique reactivity and potential applications in drug development and materials science. The presence of the fluorine atom enhances the compound's electronic properties, potentially influencing its biological activity and solubility. Additionally, the methyl group on the phenyl ring may affect steric hindrance and overall molecular interactions. As a boronic acid, it can participate in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Its specific characteristics, such as solubility, melting point, and stability, would depend on the molecular structure and environmental conditions.
Formula:C14H14BFO3
InChI:InChI=1S/C14H14BFO3/c1-10-5-6-14(13(7-10)15(17)18)19-9-11-3-2-4-12(16)8-11/h2-8,17-18H,9H2,1H3
InChI key:InChIKey=OXODKPOWGXXKNW-UHFFFAOYSA-N
SMILES:O(CC1=CC(F)=CC=C1)C2=C(B(O)O)C=C(C)C=C2
Synonyms:- B-[2-[(3-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid
- Boronic acid, B-[2-[(3-fluorophenyl)methoxy]-5-methylphenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
