CAS 1256355-85-7
:B-[2-[(2,6-Dichlorophenyl)methoxy]phenyl]boronic acid
Description:
B-[2-[(2,6-Dichlorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a biphenyl structure with a methoxy group and a dichlorophenyl substituent, contributing to its unique chemical properties. The presence of chlorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. Boronic acids are often utilized in organic synthesis, particularly in Suzuki coupling reactions, which are pivotal for forming carbon-carbon bonds. Additionally, this compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility and stability in various solvents can vary, making it essential to consider these factors in practical applications. Overall, B-[2-[(2,6-Dichlorophenyl)methoxy]phenyl]boronic acid represents a versatile building block in both synthetic and medicinal chemistry.
Formula:C13H11BCl2O3
InChI:InChI=1S/C13H11BCl2O3/c15-11-5-3-6-12(16)9(11)8-19-13-7-2-1-4-10(13)14(17)18/h1-7,17-18H,8H2
InChI key:InChIKey=GMDQQBXOTWOKNM-UHFFFAOYSA-N
SMILES:C(OC1=C(B(O)O)C=CC=C1)C2=C(Cl)C=CC=C2Cl
Synonyms:- Boronic acid, B-[2-[(2,6-dichlorophenyl)methoxy]phenyl]-
- B-[2-[(2,6-Dichlorophenyl)methoxy]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
