CAS 1256355-86-8

B-[4-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid

Description:

B-[4-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a methoxy group and a chlorofluorophenyl moiety, contributing to its unique chemical properties. The presence of the chlorine and fluorine atoms enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Boronic acids are often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, making this compound valuable in organic synthesis. Additionally, its structural features may impart specific biological activities, making it a candidate for further investigation in drug discovery. The compound is typically handled with care due to the presence of halogenated substituents, which may pose environmental and health concerns. Overall, B-[4-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid exemplifies the versatility and significance of boronic acids in modern chemistry.

Formula: C₁₃H₁₁BClFO₃

InChI: InChI=1S/C13H11BClFO3/c15-13-7-11(16)4-1-9(13)8-19-12-5-2-10(3-6-12)14(17)18/h1-7,17-18H,8H2

InChI key: InChIKey=KEFWTNCBALFSDI-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(F)C=C1)C2=CC=C(B(O)O)C=C2

Synonyms:

• B-[4-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid
• Boronic acid, B-[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-

4-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid

CAS: 1256355-86-8

Formula: C₁₃H₁₁BClFO₃

Molecular weight: 280.4870

Ref: IN-DA000O4O