CAS 1256358-44-7
:B-[4-[(3,4-Dichlorophenyl)methoxy]phenyl]boronic acid
Description:
B-[4-[(3,4-Dichlorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a biphenyl structure with a methoxy group and a dichlorophenyl substituent, contributing to its potential applications in medicinal chemistry and materials science. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the dichlorophenyl group may enhance the compound's biological activity or selectivity in various applications. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity and functional properties make it a subject of interest in research areas such as drug development and organic synthesis. Safety data should be consulted for handling, as boronic acids can have specific hazards associated with their use.
Formula:C13H11BCl2O3
InChI:InChI=1S/C13H11BCl2O3/c15-12-6-1-9(7-13(12)16)8-19-11-4-2-10(3-5-11)14(17)18/h1-7,17-18H,8H2
InChI key:InChIKey=JVNVVJSQSXECFD-UHFFFAOYSA-N
SMILES:O(CC1=CC(Cl)=C(Cl)C=C1)C2=CC=C(B(O)O)C=C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
