CAS 1256358-45-8

B-[3-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid

Description:

B-[3-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a methoxy group and a chlorofluorophenyl moiety, contributing to its unique chemical properties. The presence of the chlorine and fluorine atoms enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Boronic acids are often utilized in Suzuki coupling reactions, making this compound valuable in organic synthesis. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic rings, which may affect its interactions in biological systems. Overall, B-[3-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₃H₁₁BClFO₃

InChI: InChI=1S/C13H11BClFO3/c15-13-7-11(16)5-4-9(13)8-19-12-3-1-2-10(6-12)14(17)18/h1-7,17-18H,8H2

InChI key: InChIKey=IFDDLUOJDSKVCV-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(F)C=C1)C2=CC(B(O)O)=CC=C2

Synonyms:

• B-[3-[(2-Chloro-4-fluorophenyl)methoxy]phenyl]boronic acid
• Boronic acid, B-[3-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-
• 3-(2-Chloro-4-fluorophenylMethoxy)phenylboronic acid
• (3-((2-Chloro-4-fluorobenzyl)oxy)phenyl)boronic acid

3-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid

CAS: 1256358-45-8

Formula: C₁₃H₁₁BClFO₃

Molecular weight: 280.4870

Ref: IN-DA000O5Z