CAS 1256358-51-6

B-[2-[(2-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid

Description:

B-[2-[(2-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a complex aromatic structure, including a fluorophenyl group and a methoxy substituent, contributing to its unique chemical properties. The presence of the boronic acid moiety allows for potential applications in organic synthesis, particularly in Suzuki coupling reactions, which are widely used for the formation of carbon-carbon bonds. Additionally, the fluorine atom in the structure may enhance the compound's electronic properties and influence its reactivity. The compound's solubility and stability can vary depending on the solvent and conditions, making it suitable for various chemical applications. Overall, B-[2-[(2-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid is a versatile compound with significant potential in medicinal chemistry and materials science.

Formula: C₁₄H₁₄BFO₃

InChI: InChI=1S/C14H14BFO3/c1-10-6-7-14(12(8-10)15(17)18)19-9-11-4-2-3-5-13(11)16/h2-8,17-18H,9H2,1H3

InChI key: InChIKey=QZJJXNYJXSFEGS-UHFFFAOYSA-N

SMILES: O(CC1=C(F)C=CC=C1)C2=C(B(O)O)C=C(C)C=C2

Synonyms:

• Boronic acid, B-[2-[(2-fluorophenyl)methoxy]-5-methylphenyl]-
• B-[2-[(2-Fluorophenyl)methoxy]-5-methylphenyl]boronic acid

2-(2-Fluorophenylmethoxy)-5-methylphenylboronic acid

CAS: 1256358-51-6

Formula: C₁₄H₁₄BFO₃

Molecular weight: 260.0686

Ref: IN-DA000O5V